| FADB-China ID | P0159 |
| Molecular Name | Xanthylium, 3,6-bis(diethylamino)-9-[2-(methoxycarbonyl)phenyl]-, (T-4)-tetrachlorozincate(2-) (2:1) |
| Basis for prediction |
Rhodamine B |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.5863 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.9758 |
| Similarity (based on MCS) | 0.4459 |
| 2D Structure |  |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)OC)c3ccc(=[N+](CC)CC)cc-3oc2c1.CCN(CC)c1ccc2c(-c3ccccc3C(=O)OC)c3ccc(=[N+](CC)CC)cc-3oc2c1.Cl[Zn-2](Cl)(Cl)Cl |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |