FADB-China ID | P0160 |
Molecular Name | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatesilicate |
Basis for prediction |
Rhodamine B |
Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.4957 |
Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.8516 |
Similarity (based on MCS) | 0.0541 |
2D Structure | |
SMILES | CCNc1cc2oc3cc(=[NH+]CC)c(C)cc-3c(-c3ccccc3C(=O)OCC)c2cc1C |
CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
Update Date | Jul 30, 2019 14:16 |