Deglucobalhimycin (Predicted)
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | P1833 |
| Molecular Name | Deglucobalhimycin |
| Basis for prediction | Vancomycin |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.8197 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.9062 |
| Similarity (based on MCS) | 0.0755 |
| 2D Structure | |
| SMILES | CNC(CC(C)C)C(=O)NC1C(=O)NC(CC(N)=O)C(=O)NC2C(=O)NC3C(=O)NC(C(=O)NC(C(=O)O)c4cc(O)cc(O)c4-c4cc3ccc4O)C(OC3CC(C)(N)C(O)(O)C(C)O3)c3ccc(c(Cl)c3)Oc3cc2cc(c3O)Oc2ccc(cc2Cl)C1O |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9863 |
| Human Intestinal Absorption | HIA- | 0.8640 |
| Caco-2 Permeability | Caco2- | 0.6858 |
| P-glycoprotein Substrate | Substrate | 0.8671 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8112 |
| Non-inhibitor | 0.9482 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9615 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.4362 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8373 |
| CYP450 2D6 Substrate | Non-substrate | 0.8374 |
| CYP450 3A4 Substrate | Substrate | 0.6433 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8243 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8697 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9107 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8484 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8263 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7706 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9988 |
| Non-inhibitor | 0.8703 | |
| AMES Toxicity | Non AMES toxic | 0.6302 |
| Carcinogens | Non-carcinogens | 0.8884 |
| Fish Toxicity | High FHMT | 0.9843 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9966 |
| Honey Bee Toxicity | Low HBT | 0.7456 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.5995 |
| Carcinogenicity (Three-class) | Non-required | 0.4658 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.5959 | LogS |
| Caco-2 Permeability | -0.2364 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.6063 | LD50, mol/kg |
| Fish Toxicity | 1.1695 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.7065 | pIGC50, ug/L |
References
| Title | Data Sources |
|---|---|
| Source | DrugBank |
| PubChem Link | URL Link |