| FADB-China ID | P1852 | 
    | Molecular Name | Ethanaminium, N-[4-[bis[4-(diethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, chloride | 
    
      
      
      
        
            | Basis for prediction | 
            Malachite green | 
        
    | Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.5900 | 
    | Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.8918 | 
    | Similarity (based on MCS) | 0.6944 | 
        | 2D Structure |   | 
    | SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2ccc(N(CC)CC)cc2)cc1.[Cl-] | 
    | CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link  | 
    | Update Date | Jul 30, 2019 14:16 |