| FADB-China ID | P1856 |
| Molecular Name | Ethanaminium, N-[4-[bis[4-(diethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl- |
| Basis for prediction |
Malachite green |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.5758 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.8918 |
| Similarity (based on MCS) | 0.7143 |
| 2D Structure |  |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2ccc(N(CC)CC)cc2)cc1 |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |