| FADB-China ID | P1879 |
| Molecular Name | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[1,6-dihydro-6-oxo-4-(phenylamino)-1,3,5-triazin-2-yl]amino]-, sodium salt (1:2) |
| Basis for prediction |
Fluorescent Brightener 85 |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.6950 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.8513 |
| Similarity (based on MCS) | 0.7812 |
| 2D Structure |  |
| SMILES | O=c1nc(Nc2ccccc2)[nH]c(Nc2ccc(C=Cc3ccc(Nc4nc(=O)nc(Nc5ccccc5)[nH]4)cc3S(=O)(=O)[O-])c(S(=O)(=O)[O-])c2)n1.[Na+].[Na+] |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |