1,3-Benzenediamine, 4,4'-[1,3-phenylenebis(azo)]bis-, diacetate (Predicted)
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | P0191 |
| Molecular Name | 1,3-Benzenediamine, 4,4'-[1,3-phenylenebis(azo)]bis-, diacetate |
| Basis for prediction | Chrysoidine |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.5444 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.8611 |
| Similarity (based on MCS) | 0.4571 |
| 2D Structure | |
| SMILES | CC(=O)O.CC(=O)O.Nc1ccc(N=Nc2cccc(N=Nc3ccc(N)cc3N)c2)c(N)c1 |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.5835 |
| Human Intestinal Absorption | HIA+ | 0.8121 |
| Caco-2 Permeability | Caco2+ | 0.5050 |
| P-glycoprotein Substrate | Non-substrate | 0.6254 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8523 |
| Non-inhibitor | 0.9544 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9328 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8458 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7857 |
| CYP450 2D6 Substrate | Non-substrate | 0.8762 |
| CYP450 3A4 Substrate | Non-substrate | 0.6954 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6370 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7313 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9404 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8597 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8138 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8838 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9869 |
| Non-inhibitor | 0.9324 | |
| AMES Toxicity | AMES toxic | 0.7052 |
| Carcinogens | Carcinogens | 0.7171 |
| Fish Toxicity | High FHMT | 0.9830 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9214 |
| Honey Bee Toxicity | Low HBT | 0.8646 |
| Biodegradation | Not ready biodegradable | 0.9925 |
| Acute Oral Toxicity | III | 0.5323 |
| Carcinogenicity (Three-class) | Non-required | 0.5232 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.3387 | LogS |
| Caco-2 Permeability | 0.5445 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.0491 | LD50, mol/kg |
| Fish Toxicity | 1.2329 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5375 | pIGC50, ug/L |
References
| Title | Data Sources |
|---|---|
| Source | HPV EPA Chemicals |
| PubChem Link | URL Link |