Cefmenoxime hydrochloride (Predicted)
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | P2224 |
| Molecular Name | Cefmenoxime hydrochloride |
| Basis for prediction | Ceftiofur |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.5322 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.8958 |
| Similarity (based on MCS) | 0.3836 |
| 2D Structure | |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CSC12)c1csc(N)n1.CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CSC12)c1csc(N)n1.Cl |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9785 |
| Human Intestinal Absorption | HIA- | 0.6633 |
| Caco-2 Permeability | Caco2- | 0.7714 |
| P-glycoprotein Substrate | Substrate | 0.7216 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8576 |
| Inhibitor | 0.8386 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7927 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4156 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7459 |
| CYP450 2D6 Substrate | Non-substrate | 0.8142 |
| CYP450 3A4 Substrate | Substrate | 0.5662 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7526 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6771 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8688 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6715 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.8568 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5153 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9780 |
| Non-inhibitor | 0.6895 | |
| AMES Toxicity | Non AMES toxic | 0.7067 |
| Carcinogens | Non-carcinogens | 0.8155 |
| Fish Toxicity | High FHMT | 0.9871 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9708 |
| Honey Bee Toxicity | Low HBT | 0.6676 |
| Biodegradation | Not ready biodegradable | 0.9955 |
| Acute Oral Toxicity | III | 0.5024 |
| Carcinogenicity (Three-class) | Non-required | 0.4847 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.3617 | LogS |
| Caco-2 Permeability | -0.3070 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.2730 | LD50, mol/kg |
| Fish Toxicity | 1.2357 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6668 | pIGC50, ug/L |
References
| Title | Data Sources |
|---|---|
| Source | ToxCast & Tox21 Chemicals |
| PubChem Link | URL Link |