| FADB-China ID | P2267 |
| Molecular Name | .alpha.-D-Glucopyranoside, .beta.-D-fructofuranosyl O-.alpha.-D-galactopyranosyl-( 1.fwdarw.6)-O-.alpha.-D-g alactopyranosyl-(1.fwdarw.6)- |
| Basis for prediction |
Sucrose |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.6455 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.9836 |
| Similarity (based on MCS) | 0.5111 |
| 2D Structure |  |
| SMILES | OCC1OC(OCC2OC(OCC3OC(OC4(CO)OC(CO)C(O)C4O)C(O)C(O)C3O)C(O)C(O)C2O)C(O)C(O)C1O |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |