(11alpha,14beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione (Predicted)
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | P2323 |
| Molecular Name | (11alpha,14beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione |
| Basis for prediction | Fluoxymesterone |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.5146 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.6834 |
| Similarity (based on MCS) | 0.8519 |
| 2D Structure | |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9383 |
| Human Intestinal Absorption | HIA+ | 0.9918 |
| Caco-2 Permeability | Caco2- | 0.5096 |
| P-glycoprotein Substrate | Substrate | 0.7861 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7847 |
| Non-inhibitor | 0.8383 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7463 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8362 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8496 |
| CYP450 2D6 Substrate | Non-substrate | 0.9138 |
| CYP450 3A4 Substrate | Substrate | 0.7407 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9406 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9072 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9418 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9253 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8902 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9095 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9500 |
| Non-inhibitor | 0.5840 | |
| AMES Toxicity | Non AMES toxic | 0.9132 |
| Carcinogens | Non-carcinogens | 0.9597 |
| Fish Toxicity | High FHMT | 0.9833 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9848 |
| Honey Bee Toxicity | High HBT | 0.7998 |
| Biodegradation | Not ready biodegradable | 0.9250 |
| Acute Oral Toxicity | III | 0.7997 |
| Carcinogenicity (Three-class) | Non-required | 0.7360 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.0321 | LogS |
| Caco-2 Permeability | 0.8616 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.8914 | LD50, mol/kg |
| Fish Toxicity | 1.0228 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.9935 | pIGC50, ug/L |
References
| Title | Data Sources |
|---|---|
| Source | DrugBank, ToxinDB, ToxCast & Tox21 Chemicals |
| PubChem Link | URL Link |