1,2,5,8-tetrahydroxyanthracene-9,10-dione (Predicted)
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | P2694 |
| Molecular Name | 1,2,5,8-tetrahydroxyanthracene-9,10-dione |
| Basis for prediction | Emodin |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.4706 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.8579 |
| Similarity (based on MCS) | 0.8182 |
| 2D Structure | |
| SMILES | O=C1c2ccc(O)c(O)c2C(=O)c2c(O)ccc(O)c21 |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.5200 |
| Human Intestinal Absorption | HIA+ | 0.9759 |
| Caco-2 Permeability | Caco2- | 0.6209 |
| P-glycoprotein Substrate | Substrate | 0.5000 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9289 |
| Non-inhibitor | 0.9555 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9187 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7846 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8186 |
| CYP450 2D6 Substrate | Non-substrate | 0.9120 |
| CYP450 3A4 Substrate | Non-substrate | 0.6719 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.8636 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.6130 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8724 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8994 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9015 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8609 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9663 |
| Non-inhibitor | 0.8604 | |
| AMES Toxicity | AMES toxic | 0.9370 |
| Carcinogens | Non-carcinogens | 0.9198 |
| Fish Toxicity | High FHMT | 0.9921 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9946 |
| Honey Bee Toxicity | High HBT | 0.6405 |
| Biodegradation | Not ready biodegradable | 0.8233 |
| Acute Oral Toxicity | III | 0.5724 |
| Carcinogenicity (Three-class) | Warning | 0.5731 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.8428 | LogS |
| Caco-2 Permeability | 0.3156 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5292 | LD50, mol/kg |
| Fish Toxicity | -0.4325 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.7044 | pIGC50, ug/L |
References
| Title | Data Sources |
|---|---|
| Source | DrugBank, ToxCast & Tox21 Chemicals |
| PubChem Link | URL Link |