(S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one (Predicted)
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | P2717 |
| Molecular Name | (S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
| Basis for prediction | Sertraline |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.6809 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.6280 |
| Similarity (based on MCS) | 0.8571 |
| 2D Structure | |
| SMILES | O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9695 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.8097 |
| P-glycoprotein Substrate | Non-substrate | 0.7042 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6362 |
| Non-inhibitor | 0.9001 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7758 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8053 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7782 |
| CYP450 2D6 Substrate | Non-substrate | 0.8140 |
| CYP450 3A4 Substrate | Substrate | 0.5146 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.8805 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.6863 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9105 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5098 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7851 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5135 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8196 |
| Non-inhibitor | 0.7826 | |
| AMES Toxicity | AMES toxic | 0.6638 |
| Carcinogens | Non-carcinogens | 0.8674 |
| Fish Toxicity | High FHMT | 0.9636 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9980 |
| Honey Bee Toxicity | High HBT | 0.6770 |
| Biodegradation | Not ready biodegradable | 0.9797 |
| Acute Oral Toxicity | III | 0.6042 |
| Carcinogenicity (Three-class) | Non-required | 0.4651 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -5.4295 | LogS |
| Caco-2 Permeability | 1.9702 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3105 | LD50, mol/kg |
| Fish Toxicity | 0.6380 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.4582 | pIGC50, ug/L |
References
| Title | Data Sources |
|---|---|
| Source | FRCD |
| PubChem Link | URL Link |