Fumaric acid
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0011 |
| Substance Name | Fumaric acid |
| Substance Chinese Name | 富马酸 |
| Molecular Name | Fumaric acid |
| Molecular Chinese Name | 富马酸 |
| 2D Structure | |
| CAS Number | 110-17-8 |
| PubChem CID | 444972 |
| Formula | C4H4O4 |
| IUPAC Name | (E)-but-2-enedioic acid |
| InChI Key | VZCYOOQTPOCHFL-OWOJBTEDSA-N |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
| Canonical SMILES | C(=CC(=O)O)C(=O)O |
| Isomeric SMILES | C(=C/C(=O)O)\C(=O)O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing, Circulation |
| Addition Purposes | Antiseptic |
| Molecular Synonyms |
Fumaric acid
110-17-8
2-Butenedioic acid
Trans-Butenedioic acid
Boletic acid
Lichenic acid
Fumarate
(2E)-but-2-enedioic acid
Tumaric acid
Allomaleic acid
|
| Data Uploader | MinQing Cai |
| Update Date | Aug 02, 2019 10:42 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 116.07 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Complexity | 119 |
| Monoisotopic Mass | 116.010958607 |
| Exact Mass | 116.010958607 |
| XLogP | -0.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 8 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9017 |
| Human Intestinal Absorption | HIA+ | 0.8740 |
| Caco-2 Permeability | Caco2- | 0.6728 |
| P-glycoprotein Substrate | Non-substrate | 0.8006 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9850 |
| Non-inhibitor | 0.9808 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9583 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7863 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8262 |
| CYP450 2D6 Substrate | Non-substrate | 0.9397 |
| CYP450 3A4 Substrate | Non-substrate | 0.8039 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9659 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9490 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9606 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9773 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9554 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9899 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9836 |
| Non-inhibitor | 0.9891 | |
| AMES Toxicity | Non AMES toxic | 0.9132 |
| Carcinogens | Non-carcinogens | 0.5130 |
| Fish Toxicity | High FHMT | 0.8398 |
| Tetrahymena Pyriformis Toxicity | Low TPT | 0.9808 |
| Honey Bee Toxicity | High HBT | 0.7308 |
| Biodegradation | Ready biodegradable | 0.7561 |
| Acute Oral Toxicity | III | 0.7762 |
| Carcinogenicity (Three-class) | Non-required | 0.7191 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -0.3321 | LogS |
| Caco-2 Permeability | 0.4098 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.6871 | LD50, mol/kg |
| Fish Toxicity | 0.9694 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | -0.6339 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0012 |
| Food Image | ![]() |
| Food Name | Pastry |
| Food Chinese Name | 糕点 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (second batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Ferrous fumarate |
ToxinDB |
Link |
||
25085-79-4 |
FRCD |
Link |
||
Ferrous fumarate |
ToxinDB, OpenFoodTox |
Link |
||
Fumarate |
DrugBank, ToxinDB |
Link |
||
Fumarate |
DrugBank, ToxinDB |
Link |
||
Disodium Fumarate |
FRCD |
Link |
||
Sodium Hydrogen Maleate |
FRCD |
Link |
||
Potassium Fumarate |
FRCD |
Link |
||
2-Butenedioic Acid (E)-, Polymer With 1,2-Ethanediol |
FRCD |
Link |
||
2-Butenedioic acid (2Z)-, polymer with 2-propenoic acid |
HPV EPA Chemicals |
Link |
||
Hydrogen maleate |
FRCD |
Link |
||
Citraconic acid |
DrugBank |
Link |
