Condiment
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0011 |
| Food Name | Condiment |
| Chinese Name | 调味品 |
| Picture | ![]() |
| Food Group | 调味品 |
| Food Type | Processed food |
| Update Date | Jul 11, 2019 10:34 |
Illegal Additives
| CFAD ID | C0009 |
| Substance | Industry Dyes |
| Molecule | Rhodamine B |
| Involved Links | Processing, Circulation |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C28H31ClN2O3 |
| InChi Key | PYWVYCXTNDRMGF-UHFFFAOYSA-N |
| Isomeric SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-] |
| Detection Method |
Predicted Illegal Additives
| ID | P0002 |
| Name | Rhodamine B |
| Structure | |
| Source | T3DB |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
| ID | P0154 |
| Name | Rhodamine 6g |
| Structure | |
| Source | DrugBank, HPV EPA Chemicals |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
| ID | P0155 |
| Name | Basic Red 1 |
| Structure | |
| Source | HPV EPA Chemicals, T3DB, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 3 |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
| ID | P0157 |
| Name | Rhodamine 6g |
| Structure | |
| Source | T3DB |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
| ID | P0159 |
| Name | Xanthylium, 3,6-bis(diethylamino)-9-[2-(methoxycarbonyl)phenyl]-, (T-4)-tetrachlorozincate(2-) (2:1) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
| ID | P0160 |
| Name | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatesilicate |
| Structure | |
| Source | DrugBank, HPV EPA Chemicals |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
| ID | P0161 |
| Name | Rhodamine 6g |
| Structure | |
| Source | HPV EPA Chemicals, T3DB, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 3 |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
| ID | P0156 |
| Name | Rhodamine 123 |
| Structure | |
| Source | T3DB |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
| ID | P0158 |
| Name | Xanthylium, 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethyl-, molybdatetungstatephosphate |
| Structure | |
| Source | DrugBank, HPV EPA Chemicals |
| Basis of prediction | Rhodamine B |
| PubChem Link | Link |
