Mooncake
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0063 |
| Food Name | Mooncake |
| Chinese Name | 月饼 |
| Picture | ![]() |
| Food Group | 糕点 |
| Food Type | Processed food |
| Update Date | Jul 11, 2019 14:27 |
Illegal Additives
| CFAD ID | C0045 |
| Substance | Colorant |
| Molecule | Carmine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C22H20O13 |
| InChi Key | DGQLVPJVXFOQEV-JNVSTXMASA-N |
| Isomeric SMILES | CC1=C2C(=CC(=C1C(=O)O)O)C(=O)C3=C(C2=O)C(=C(C(=C3O)O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| Detection Method | GB/T 5009.35-2003 Determination of synthetic colorants in foods |
| CFAD ID | C0046 |
| Substance | Colorant |
| Molecule | Tartrazine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C16H9N4Na3O9S2 |
| InChi Key | UJMBCXLDXJUMFB-UHFFFAOYSA-K |
| Isomeric SMILES | C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+] |
| Detection Method | GB/T 5009.35-2003 Determination of synthetic colorants in foods |
| CFAD ID | C0049 |
| Substance | Colorant |
| Molecule | Allura Red |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C18H14N2Na2O8S2 |
| InChi Key | CEZCCHQBSQPRMU-UHFFFAOYSA-L |
| Isomeric SMILES | CC1=CC(=C(C=C1S(=O)(=O)[O-])OC)N=NC2=C(C=CC3=C2C=CC(=C3)S(=O)(=O)[O-])O.[Na+].[Na+] |
| Detection Method | GB/T 5009.35-2003 Determination of synthetic colorants in foods, GB/T 5009.141-2003 Determination of alluring red in foods |
| CFAD ID | C0051 |
| Substance | Colorant |
| Molecule | Sunset yellow |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C16H10N2Na2O7S2 |
| InChi Key | OIQPTROHQCGFEF-UHFFFAOYSA-L |
| Isomeric SMILES | C1=CC(=CC=C1N=NC2=C(C=CC3=C2C=CC(=C3)S(=O)(=O)[O-])O)S(=O)(=O)[O-].[Na+].[Na+] |
| Detection Method | GB/T 5009.35-2003 Determination of synthetic colorants in foods, |
| CFAD ID | C0052 |
| Substance | Preservative |
| Molecule | 2-Phenylphenol |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C12H10O |
| InChi Key | LLEMOWNGBBNAJR-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=C(C=C1)C2=CC=CC=C2O |
| Detection Method |
| CFAD ID | C0055 |
| Substance | Preservative |
| Molecule | Acetic acid |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C2H4O2 |
| InChi Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Isomeric SMILES | CC(=O)O |
| Detection Method |
| CFAD ID | C0057 |
| Substance | Preservative |
| Molecule | Acidified Sodium Chlorite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | ClNaO2 |
| InChi Key | UKLNMMHNWFDKNT-UHFFFAOYSA-M |
| Isomeric SMILES | [O-]Cl=O.[Na+] |
| Detection Method |
| CFAD ID | C0058 |
| Substance | Preservative |
| Molecule | Benzoic acid |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C7H6O2 |
| InChi Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)O |
| Detection Method | GB/T 5009.29-2003 Determination of benzoic acid in foods by gas chromatography |
| CFAD ID | C0060 |
| Substance | Preservative |
| Molecule | Borax |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | B4H20Na2O17 |
| InChi Key | CDMADVZSLOHIFP-UHFFFAOYSA-N |
| Isomeric SMILES | B1(OB2OB(OB(O1)O2)[O-])[O-].O.O.O.O.O.O.O.O.O.O.[Na+].[Na+] |
| Detection Method |
| CFAD ID | C0061 |
| Substance | Preservative |
| Molecule | Boric acid |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | BH3O3 |
| InChi Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Isomeric SMILES | B(O)(O)O |
| Detection Method |
| CFAD ID | C0063 |
| Substance | Preservative |
| Molecule | Butyl p-hydroxybenzoate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C11H14O3 |
| InChi Key | QFOHBWFCKVYLES-UHFFFAOYSA-N |
| Isomeric SMILES | CCCCOC(=O)C1=CC=C(C=C1)O |
| Detection Method | GB/T 5009.31-2003 Determination of benzoate lipids in foods by gas chromatography |
| CFAD ID | C0065 |
| Substance | Preservative |
| Molecule | Calcium acetate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C4H6CaO4 |
| InChi Key | VSGNNIFQASZAOI-UHFFFAOYSA-L |
| Isomeric SMILES | CC(=O)[O-].CC(=O)[O-].[Ca+2] |
| Detection Method |
| CFAD ID | C0066 |
| Substance | Preservative |
| Molecule | Calcium benzoate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C23H32BBr2N3O6 |
| InChi Key | UBBUVYGQLRDKJX-UHFFFAOYSA-N |
| Isomeric SMILES | B(C(CCC(Br)Br)NC(=O)C1CCCN1C(=O)C(CC2=CC=CC=C2)NC(=O)CCCC=O)(O)O |
| Detection Method | GB/T 5009.29-2003 Determination of benzoic acid in foods by gas chromatography |
| CFAD ID | C0071 |
| Substance | Preservative |
| Molecule | Edetic acid |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C10H16N2O8 |
| InChi Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Isomeric SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Detection Method |
| CFAD ID | C0073 |
| Substance | Preservative |
| Molecule | Calcium hydrogen sulfite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | CaH2O6S2 |
| InChi Key | LVGQIQHJMRUCRM-UHFFFAOYSA-L |
| Isomeric SMILES | OS(=O)[O-].OS(=O)[O-].[Ca+2] |
| Detection Method | GB/T 5009.34-2003 Determination of sulfites in foods by pararosaniline hydrochloride method |
| CFAD ID | C0076 |
| Substance | Preservative |
| Molecule | Calcium propionate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C6H10CaO4 |
| InChi Key | BCZXFFBUYPCTSJ-UHFFFAOYSA-L |
| Isomeric SMILES | CCC(=O)[O-].CCC(=O)[O-].[Ca+2] |
| Detection Method | GB/T 5009.120-2003 Determination of calcium propionate in foods by gas chromatography |
| CFAD ID | C0079 |
| Substance | Preservative |
| Molecule | Calcium Sorbate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C12H14CaO4 |
| InChi Key | MCFVRESNTICQSJ-RJNTXXOISA-L |
| Isomeric SMILES | C/C=C/C=C/C(=O)[O-].C/C=C/C=C/C(=O)[O-].[Ca+2] |
| Detection Method | GB/T 5009.29-2003 Determination of sorbic acid in foods by gas chromatography |
| CFAD ID | C0081 |
| Substance | Preservative |
| Molecule | Carbon dioxide |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | CO2 |
| InChi Key | CURLTUGMZLYLDI-UHFFFAOYSA-N |
| Isomeric SMILES | C(=O)=O |
| Detection Method |
| CFAD ID | C0084 |
| Substance | Preservative |
| Molecule | Copper sulfate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | CuO4S |
| InChi Key | ARUVKPQLZAKDPS-UHFFFAOYSA-L |
| Isomeric SMILES | [O-]S(=O)(=O)[O-].[Cu+2] |
| Detection Method |
| CFAD ID | C0086 |
| Substance | Preservative |
| Molecule | Diethyl pyrocarbonate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C6H10O5 |
| InChi Key | FFYPMLJYZAEMQB-UHFFFAOYSA-N |
| Isomeric SMILES | CCOC(=O)OC(=O)OCC |
| Detection Method |
| CFAD ID | C0089 |
| Substance | Preservative |
| Molecule | Dimethyl dicarbonate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C4H6O5 |
| InChi Key | GZDFHIJNHHMENY-UHFFFAOYSA-N |
| Isomeric SMILES | COC(=O)OC(=O)OC |
| Detection Method |
| CFAD ID | C0090 |
| Substance | Preservative |
| Molecule | Ethyl lauroyl arginate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C20H41ClN4O3 |
| InChi Key | CUBZMGWLVMQKNE-LMOVPXPDSA-N |
| Isomeric SMILES | CCCCCCCCCCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)OCC.Cl |
| Detection Method |
| CFAD ID | C0092 |
| Substance | Preservative |
| Molecule | Ethylene oxide |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C2H4O |
| InChi Key | IAYPIBMASNFSPL-UHFFFAOYSA-N |
| Isomeric SMILES | C1CO1 |
| Detection Method |
| CFAD ID | C0093 |
| Substance | Preservative |
| Molecule | Formic acid |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | CH2O2 |
| InChi Key | BDAGIHXWWSANSR-UHFFFAOYSA-N |
| Isomeric SMILES | C(=O)O |
| Detection Method |
| CFAD ID | C0094 |
| Substance | Preservative |
| Molecule | Hexamethylenetetramine |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C6H12N4 |
| InChi Key | VKYKSIONXSXAKP-UHFFFAOYSA-N |
| Isomeric SMILES | C1N2CN3CN1CN(C2)C3 |
| Detection Method |
| CFAD ID | C0095 |
| Substance | Preservative |
| Molecule | Hydrogen peroxide |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | H2O2 |
| InChi Key | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| Isomeric SMILES | OO |
| Detection Method |
| CFAD ID | C0096 |
| Substance | Preservative |
| Molecule | Lysozyme hydrochloride |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C40H47FN6O5 |
| InChi Key | CVVYMXAPTWLCAP-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=C(C=C(C=C1)C(=O)NC2CCCCC2)NC(=O)CN3CCC(CC3)C(=O)N4CCCC4C(=O)NC5=CC=CC(=C5)NC(=O)C6=CC=CC=C6F |
| Detection Method |
| CFAD ID | C0097 |
| Substance | Preservative |
| Molecule | Natamycin |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C33H47NO13 |
| InChi Key | NCXMLFZGDNKEPB-FFPOYIOWSA-N |
| Isomeric SMILES | C[C@@H]1C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@@H]3[C@H](O3)/C=C/C(=O)O1)O)O)O)C(=O)O)O[C@H]4[C@H]([C@H]([C@@H]([C@H](O4)C)O)N)O |
| Detection Method | GB/T 21915-2008 Determination of natamycin in foods by liquid chromatography |
| CFAD ID | C0099 |
| Substance | Preservative |
| Molecule | Nisin |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C143H230N42O37S7 |
| InChi Key | NVNLLIYOARQCIX-UHFFFAOYSA-N |
| Isomeric SMILES | CCC(C)C1C(=O)NC(=C)C(=O)NC(C(=O)NC(CSCC(C(=O)N1)NC(=O)C(=CC)NC(=O)C(C(C)CC)N)C(=O)NC2C(SCC(NC(=O)CNC(=O)C3CCCN3C2=O)C(=O)NC(CCCCN)C(=O)NC4C(SCC(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC4=O)C)CC(C)C)CCSC)C(=O)NC(CC(=O)N)C(=O)NC(CCSC)C(=O)NC(CCCCN)C(=O)NC5C(SCC6C(=O)NC(C(=O)NC(CSC(C(C(=O)N6)NC(=O)C(NC5=O)C)C)C(=O)NC(CO)C(=O)NC(C(C)CC)C(=O)NC(CC7=CN=CN7)C(=O)NC(C(C)C)C(=O)NC(=C)C(=O)NC(CCCCN)C(=O)O)CC8=CN=CN8)C)C)C)CC(C)C |
| Detection Method |
| CFAD ID | C0101 |
| Substance | Preservative |
| Molecule | Nitrate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | NO3- |
| InChi Key | NHNBFGGVMKEFGY-UHFFFAOYSA-N |
| Isomeric SMILES | [N+](=O)([O-])[O-] |
| Detection Method |
| CFAD ID | C0102 |
| Substance | Preservative |
| Molecule | Nitrite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | NO2- |
| InChi Key | IOVCWXUNBOPUCH-UHFFFAOYSA-M |
| Isomeric SMILES | N(=O)[O-] |
| Detection Method | GB/T 5009.33-2010 Determination of nitrite and nitrite in food by ion chromatography |
| CFAD ID | C0103 |
| Substance | Preservative |
| Molecule | Potassium acetate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C2H3KO2 |
| InChi Key | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Isomeric SMILES | CC(=O)[O-].[K+] |
| Detection Method |
| CFAD ID | C0106 |
| Substance | Preservative |
| Molecule | Potassium benzoate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C7H5KO2 |
| InChi Key | XAEFZNCEHLXOMS-UHFFFAOYSA-M |
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)[O-].[K+] |
| Detection Method | GB/T 5009.29-2003 Determination of sorbic acid and benzoic acid in foods by gas chromatography |
| CFAD ID | C0107 |
| Substance | Preservative |
| Molecule | Potassium hydrogen sulfate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | HKO3S |
| InChi Key | DJEHXEMURTVAOE-UHFFFAOYSA-M |
| Isomeric SMILES | OS(=O)[O-].[K+] |
| Detection Method | GB/T 5009.34-2003 determination of sulfites in foods by pararosaniline hydrochloride method |
| CFAD ID | C0108 |
| Substance | Preservative |
| Molecule | Potassium metabisulfite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | K2O5S2 |
| InChi Key | RWPGFSMJFRPDDP-UHFFFAOYSA-L |
| Isomeric SMILES | [O-]S(=O)S(=O)(=O)[O-].[K+].[K+] |
| Detection Method | GB/T 5009.34-2003 determination of sulfites in foods by pararosaniline hydrochloride method |
| CFAD ID | C0109 |
| Substance | Preservative |
| Molecule | Potassium nitrate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | KNO3 |
| InChi Key | FGIUAXJPYTZDNR-UHFFFAOYSA-N |
| Isomeric SMILES | [N+](=O)([O-])[O-].[K+] |
| Detection Method | GB/T 5009.33-2010 Determination of nitrite and nitrite in food by ion chromatography |
| CFAD ID | C0110 |
| Substance | Preservative |
| Molecule | Potassium nitrite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | KNO2 |
| InChi Key | BXNHTSHTPBPRFX-UHFFFAOYSA-M |
| Isomeric SMILES | N(=O)[O-].[K+] |
| Detection Method | GB/T 5009.33-2010 Determination of nitrite and nitrite in food by ion chromatography |
| CFAD ID | C0111 |
| Substance | Preservative |
| Molecule | Potassium propionate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C3H5KO2 |
| InChi Key | BWILYWWHXDGKQA-UHFFFAOYSA-M |
| Isomeric SMILES | CCC(=O)[O-].[K+] |
| Detection Method |
| CFAD ID | C0113 |
| Substance | Preservative |
| Molecule | Potassium Sorbate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C6H7KO2 |
| InChi Key | CHHHXKFHOYLYRE-STWYSWDKSA-M |
| Isomeric SMILES | C/C=C/C=C/C(=O)[O-].[K+] |
| Detection Method | GB/T 5009.29-2003 Determination of sorbic acid and benzoic acid in foods by gas chromatography |
| CFAD ID | C0114 |
| Substance | Preservative |
| Molecule | Potassium sulfite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | K2O3S |
| InChi Key | BHZRJJOHZFYXTO-UHFFFAOYSA-L |
| Isomeric SMILES | [O-]S(=O)[O-].[K+].[K+] |
| Detection Method |
| CFAD ID | C0115 |
| Substance | Preservative |
| Molecule | Propionic acid |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C3H6O2 |
| InChi Key | XBDQKXXYIPTUBI-UHFFFAOYSA-N |
| Isomeric SMILES | CCC(=O)O |
| Detection Method |
| CFAD ID | C0117 |
| Substance | Preservative |
| Molecule | Propylene oxide |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C3H6O |
| InChi Key | GOOHAUXETOMSMM-UHFFFAOYSA-N |
| Isomeric SMILES | CC1CO1 |
| Detection Method |
| CFAD ID | C0118 |
| Substance | Preservative |
| Molecule | Salicylic acid |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C7H6O3 |
| InChi Key | YGSDEFSMJLZEOE-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=C(C(=C1)C(=O)O)O |
| Detection Method |
| CFAD ID | C0119 |
| Substance | Preservative |
| Molecule | Sodium benzoate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C7H5NaO2 |
| InChi Key | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)[O-].[Na+] |
| Detection Method | GB/T 5009.29-2003 Determination of sorbic acid and benzoic acid in foods by gas chromatography |
| CFAD ID | C0120 |
| Substance | Preservative |
| Molecule | Sodium chlorite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | ClNaO2 |
| InChi Key | UKLNMMHNWFDKNT-UHFFFAOYSA-M |
| Isomeric SMILES | [O-]Cl=O.[Na+] |
| Detection Method |
| CFAD ID | C0121 |
| Substance | Preservative |
| Molecule | Sodium diacetate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C4H7NaO4 |
| InChi Key | BHZOKUMUHVTPBX-UHFFFAOYSA-M |
| Isomeric SMILES | CC(=O)O.CC(=O)[O-].[Na+] |
| Detection Method | GB/T 23383-2009 Determination of sodium diacetate in foods by liquid chromatography |
| CFAD ID | C0124 |
| Substance | Preservative |
| Molecule | Sodium dichloroisocyanurate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C3Cl2N3NaO3 |
| InChi Key | MSFGZHUJTJBYFA-UHFFFAOYSA-M |
| Isomeric SMILES | C1(=O)[N-]C(=O)N(C(=O)N1Cl)Cl.[Na+] |
| Detection Method |
| CFAD ID | C0125 |
| Substance | Preservative |
| Molecule | Sodium hydrogen sulfite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | HNaO3S |
| InChi Key | DWAQJAXMDSEUJJ-UHFFFAOYSA-M |
| Isomeric SMILES | OS(=O)[O-].[Na+] |
| Detection Method | GB/T 5009.34-2003 determination of sulfites in foods by pararosaniline hydrochloride method |
| CFAD ID | C0127 |
| Substance | Preservative |
| Molecule | Sodium metabisulfite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | Na2O5S2 |
| InChi Key | HRZFUMHJMZEROT-UHFFFAOYSA-L |
| Isomeric SMILES | [O-]S(=O)S(=O)(=O)[O-].[Na+].[Na+] |
| Detection Method | GB/T 5009.34-2003 determination of sulfites in foods by pararosaniline hydrochloride method |
| CFAD ID | C0130 |
| Substance | Preservative |
| Molecule | Sodium nitrate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | NNaO3 |
| InChi Key | VWDWKYIASSYTQR-UHFFFAOYSA-N |
| Isomeric SMILES | [N+](=O)([O-])[O-].[Na+] |
| Detection Method | GB/T 5009.33-2010 Determination of nitrite and nitrite in food by ion chromatography |
| CFAD ID | C0131 |
| Substance | Preservative |
| Molecule | Sodium nitrite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | NNaO2 |
| InChi Key | LPXPTNMVRIOKMN-UHFFFAOYSA-M |
| Isomeric SMILES | N(=O)[O-].[Na+] |
| Detection Method | GB/T 5009.33-2010 Determination of nitrite and nitrite in food by ion chromatography |
| CFAD ID | C0134 |
| Substance | Preservative |
| Molecule | Sodium o-phenylphenate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C12H9NaO |
| InChi Key | KSQXVLVXUFHGJQ-UHFFFAOYSA-M |
| Isomeric SMILES | C1=CC=C(C=C1)C2=CC=CC=C2[O-].[Na+] |
| Detection Method |
| CFAD ID | C0136 |
| Substance | Preservative |
| Molecule | Sodium propionate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C3H5NaO2 |
| InChi Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Isomeric SMILES | CCC(=O)[O-].[Na+] |
| Detection Method | GB/T 5009.120-2003 Determination of sodium propionate and calcium propionate in food by gas chromatography |
| CFAD ID | C0138 |
| Substance | Preservative |
| Molecule | Sodium Sorbate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C6H7NaO2 |
| InChi Key | LROWVYNUWKVTCU-STWYSWDKSA-M |
| Isomeric SMILES | C/C=C/C=C/C(=O)[O-].[Na+] |
| Detection Method | GB/T 5009.29-2003 Determination of sorbic acid and benzoic acid in foods by gas chromatography |
| CFAD ID | C0140 |
| Substance | Preservative |
| Molecule | Sodium sulfite |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | Na2O3S |
| InChi Key | GEHJYWRUCIMESM-UHFFFAOYSA-L |
| Isomeric SMILES | [O-]S(=O)[O-].[Na+].[Na+] |
| Detection Method | GB/T 5009.34-2003 determination of sulfites in foods by pararosaniline hydrochloride method |
| CFAD ID | C0142 |
| Substance | Preservative |
| Molecule | Sodium Thiocyanate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | CNNaS |
| InChi Key | VGTPCRGMBIAPIM-UHFFFAOYSA-M |
| Isomeric SMILES | C(#N)[S-].[Na+] |
| Detection Method |
| CFAD ID | C0143 |
| Substance | Preservative |
| Molecule | Sodium thiosulfate |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | Na2O3S2 |
| InChi Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Isomeric SMILES | [O-]S(=O)(=S)[O-].[Na+].[Na+] |
| Detection Method |
| CFAD ID | C0144 |
| Substance | Preservative |
| Molecule | Sorbic acid |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | C6H8O2 |
| InChi Key | WSWCOQWTEOXDQX-MQQKCMAXSA-N |
| Isomeric SMILES | C/C=C/C=C/C(=O)O |
| Detection Method | GB/T 5009.29-2003 Determination of sorbic acid and benzoic acid in foods by gas chromatography |
| CFAD ID | C0145 |
| Substance | Preservative |
| Molecule | Sulfur dioxide |
| Involved Links | Transportation, Processing, Circulation |
| Structure | |
| Purpose of Addition | Antiseptic |
| Formula | O2S |
| InChi Key | RAHZWNYVWXNFOC-UHFFFAOYSA-N |
| Isomeric SMILES | O=S=O |
| Detection Method | GB/T 5009.34-2003 determination of sulfites in foods by pararosaniline hydrochloride method |
| CFAD ID | C0148 |
| Substance | Sweetening agent |
| Molecule | Saccharinnatrium |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve taste |
| Formula | C7H4NNaO3S |
| InChi Key | WINXNKPZLFISPD-UHFFFAOYSA-M |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=O)[N-]S2(=O)=O.[Na+] |
| Detection Method |
| CFAD ID | C0150 |
| Substance | Sweetening agent |
| Molecule | Cyclamate |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve taste |
| Formula | C6H13NO3S |
| InChi Key | HCAJEUSONLESMK-UHFFFAOYSA-N |
| Isomeric SMILES | C1CCC(CC1)NS(=O)(=O)O |
| Detection Method |
| CFAD ID | C0152 |
| Substance | Sweetening agent |
| Molecule | Acesulfame potassium |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve taste |
| Formula | C4H4KNO4S |
| InChi Key | WBZFUFAFFUEMEI-UHFFFAOYSA-M |
| Isomeric SMILES | CC1=CC(=O)[N-]S(=O)(=O)O1.[K+] |
| Detection Method |
| CFAD ID | C0154 |
| Substance | Emulgator |
| Molecule | Sucrose fatty acid ester |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Emulsify |
| Formula | C30H38N3O+ |
| InChi Key | OBEAZDXGNSDRAR-UHFFFAOYSA-N |
| Isomeric SMILES | CC1(CC[N+]2(CCC(C3=CC=CC1=C32)(C)C)C(=C)C4=CCC(=C(C#N)C#N)C(O4)C(C)(C)C)C |
| Detection Method |
| CFAD ID | C0273 |
| Substance | Emulgator |
| Molecule | Acetylated mono-glycine fatty acid ester |
| Involved Links | Processing |
| Detection Method |
Predicted Illegal Additives
| ID | P1049 |
| Name | Allura red AC |
| Structure | |
| Source | T3DB |
| Basis of prediction | Allura Red |
| PubChem Link | Link |
| ID | P1050 |
| Name | C.I. Pigment Yellow 104 |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sunset yellow |
| PubChem Link | Link |
| ID | P1051 |
| Name | Disodium 6-hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalenesulfonate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Sunset yellow |
| PubChem Link | Link |
| ID | P1052 |
| Name | 6-Hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalenesulfonic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sunset yellow |
| PubChem Link | Link |
| ID | P1053 |
| Name | Sodium 2-Biphenylate |
| Structure | |
| Source | FRCD |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1054 |
| Name | 4-Bromobiphenyl |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, IARC Carcinogens Group 2A, National Health Commission of the People's Republic of China, HPV EPA Chemicals, T3DB |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1055 |
| Name | 4-Methyl-1,1'-biphenyl |
| Structure | |
| Source | FRCD |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1057 |
| Name | Biphenyl-2,3-Diol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1058 |
| Name | 2'-Chloro-Biphenyl-2,3-Diol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1060 |
| Name | 2-Chlorobiphenyl |
| Structure | |
| Source | HPV EPA Chemicals, National Health Commission of the People's Republic of China, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1061 |
| Name | 3-Chlorobiphenyl |
| Structure | |
| Source | HPV EPA Chemicals, National Health Commission of the People's Republic of China, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1062 |
| Name | 4-Chlorobiphenyl |
| Structure | |
| Source | HPV EPA Chemicals, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 1 |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1063 |
| Name | 4-Methylbiphenyl |
| Structure | |
| Source | FRCD |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1064 |
| Name | 4-Phenylphenol |
| Structure | |
| Source | FRCD |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1065 |
| Name | Aroclor 1221 |
| Structure | |
| Source | HPV EPA Chemicals, National Health Commission of the People's Republic of China, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1066 |
| Name | 2-Monobromobiphenyl |
| Structure | |
| Source | T3DB |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1067 |
| Name | 3-Monobromobiphenyl |
| Structure | |
| Source | HPV EPA Chemicals, IARC Carcinogens Group 2A, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1068 |
| Name | 4-Monobromobiphenyl |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, IARC Carcinogens Group 2A, National Health Commission of the People's Republic of China, HPV EPA Chemicals, T3DB |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1069 |
| Name | 3-Aminobiphenyl |
| Structure | |
| Source | T3DB |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1070 |
| Name | 4-METHYLBIPHENYL |
| Structure | |
| Source | FRCD |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1071 |
| Name | Isobutyrophenetidide |
| Structure | |
| Source | FRCD |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1072 |
| Name | O-Aminobiphenyl |
| Structure | |
| Source | OECD HPV Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1073 |
| Name | 3-Phenylphenol |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1056 |
| Name | Biphenyl |
| Structure | |
| Source | FRCD |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P1059 |
| Name | 4-Aminobiphenyl |
| Structure | |
| Source | HPV EPA Chemicals, T3DB, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 1 |
| Basis of prediction | 2-Phenylphenol |
| PubChem Link | Link |
| ID | P0015 |
| Name | Ammonium acetate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P0016 |
| Name | Barium acetate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1120 |
| Name | Basic lead acetate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1131 |
| Name | POTASSIUM ACETATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1075 |
| Name | Calcium acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1076 |
| Name | Sodium acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1077 |
| Name | Sodium diacetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1079 |
| Name | Palladium acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1080 |
| Name | Cobalt acetate tetrahydrate |
| Structure | |
| Source | T3DB, OpenFoodTox, OECD HPV Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1081 |
| Name | Ammonium acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1082 |
| Name | Cupric acetate, monohydrate |
| Structure | |
| Source | T3DB, OpenFoodTox |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1083 |
| Name | Zinc acetate, dihydrate |
| Structure | |
| Source | T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1084 |
| Name | Acetic acid |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1085 |
| Name | Calcium Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1086 |
| Name | Mangosteen |
| Structure | |
| Source | T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1087 |
| Name | Mercury(Ii) Acetate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1089 |
| Name | Cadmium Acetate |
| Structure | |
| Source | T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1090 |
| Name | Beryllium Acetate |
| Structure | |
| Source | FRCD, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1091 |
| Name | Cobalt(Iii) Acetate |
| Structure | |
| Source | IARC Carcinogens Group 2B, T3DB, FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1093 |
| Name | Manganous Acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1094 |
| Name | Manganese Triacetate |
| Structure | |
| Source | FRCD, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1095 |
| Name | Zinc Acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1096 |
| Name | Chromium(Ii) Acetate |
| Structure | |
| Source | FRCD, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1097 |
| Name | Chromium(Iii) Acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 3 |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1098 |
| Name | Silver Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1099 |
| Name | Antimony Acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1100 |
| Name | Ammonium Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1101 |
| Name | Magnesium Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1102 |
| Name | Potassium Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1103 |
| Name | Sodium Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1104 |
| Name | Sodium Diacetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1105 |
| Name | Barium Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1106 |
| Name | Copper(Ii) Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1107 |
| Name | Acetate |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1109 |
| Name | Palladium(Ii) Acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1110 |
| Name | Lead Acetate |
| Structure | |
| Source | HPV EPA Chemicals, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1111 |
| Name | Basic Beryllium Acetate |
| Structure | |
| Source | FRCD, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1112 |
| Name | Cadmium acetate |
| Structure | |
| Source | T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1113 |
| Name | Basic beryllium acetate |
| Structure | |
| Source | FRCD, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1114 |
| Name | Cobalt(II) acetate |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 2B, FRCD, HPV EPA Chemicals, T3DB, OECD HPV Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1115 |
| Name | Cobalt(III) acetate |
| Structure | |
| Source | IARC Carcinogens Group 2B, T3DB, FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1116 |
| Name | Nickel acetate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1117 |
| Name | Zinc acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1118 |
| Name | Manganese triacetate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1119 |
| Name | Lead tetraacetate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1122 |
| Name | Thallium(I) acetate |
| Structure | |
| Source | HPV EPA Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1123 |
| Name | CALCIUM ACETATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1124 |
| Name | Magnesium acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1125 |
| Name | Lithium acetate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1126 |
| Name | Ruthenium(1+), hexakis[.mu.-(acetato-.kappa.O:.kappa.O')]-.mu.3-oxotri-, acetate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1127 |
| Name | Hydrazine, monoacetate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1129 |
| Name | Acetic acid, yttrium(3+) salt (3:1) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1130 |
| Name | Zinc(II) acetate dihydrate |
| Structure | |
| Source | T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1132 |
| Name | Iridium(1+), hexakis[?-(acetato-?O:?O')]triaqua-?3-oxotri-, acetate (1:1) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1133 |
| Name | Calcium magnesium acetate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1134 |
| Name | Acetic acid, cesium salt (1:1) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1135 |
| Name | Cerium(III) acetate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1136 |
| Name | Acetic acid, lanthanum(3+) salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1137 |
| Name | Cobalt diacetate (tetrahydrate) |
| Structure | |
| Source | T3DB, OpenFoodTox, OECD HPV Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1138 |
| Name | Lead(II) acetate trihydrate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1139 |
| Name | Lead acetate |
| Structure | |
| Source | HPV EPA Chemicals, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1140 |
| Name | Beryllium acetate |
| Structure | |
| Source | FRCD, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1141 |
| Name | Nickel acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1142 |
| Name | Manganous acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1143 |
| Name | Copper(II) acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1144 |
| Name | Chromium(III) acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 3 |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1145 |
| Name | Silver acetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1088 |
| Name | Mercury(I) Acetate |
| Structure | |
| Source | National Health Commission of the People's Republic of China, T3DB |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1078 |
| Name | Cobalt acetate |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 2B, FRCD, HPV EPA Chemicals, T3DB, OECD HPV Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1092 |
| Name | Nickel Acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1108 |
| Name | Cobalt(Ii) Acetate |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 2B, FRCD, HPV EPA Chemicals, T3DB, OECD HPV Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1121 |
| Name | Antimony acetate |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P1128 |
| Name | Acetic acid, antimony(3+) salt (3:1) |
| Structure | |
| Source | HPV EPA Chemicals, FRCD, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetic acid |
| PubChem Link | Link |
| ID | P0017 |
| Name | Guanidinium benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1153 |
| Name | Sodium benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1154 |
| Name | Potassium benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1155 |
| Name | Calcium benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1156 |
| Name | Mercuric Benzoate |
| Structure | |
| Source | FRCD, T3DB |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1157 |
| Name | Calcium Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1158 |
| Name | Potassium Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1159 |
| Name | Sodium Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1160 |
| Name | Ammonium Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1161 |
| Name | Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1162 |
| Name | Copper benzoate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1163 |
| Name | Ammonium benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1164 |
| Name | Benzoic acid, zinc salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1165 |
| Name | Aluminum benzoate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1166 |
| Name | Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1167 |
| Name | SODIUM BENZOATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1168 |
| Name | Benzoic acid, barium salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1169 |
| Name | Benzoic acid, cadmium salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1170 |
| Name | Benzyl alcohol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1171 |
| Name | Benzaldehyde |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1172 |
| Name | Methyl benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1173 |
| Name | 2-Chlorobenzoic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1175 |
| Name | Salicylic acid |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1176 |
| Name | 3-Hydroxybenzoic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1177 |
| Name | 4-Chlorobenzoic acid |
| Structure | |
| Source | DrugBank, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1178 |
| Name | 2-Aminobenzoic Acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, DEA Chemicals, DrugBank, HPV EPA Chemicals, CAC Veterinary Drug, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1180 |
| Name | P-Hydroxybenzoic Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1181 |
| Name | 4-Aminobenzoic Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1182 |
| Name | Mercuribenzoic Acid |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1183 |
| Name | Gabaculine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1185 |
| Name | 4-hydroxybenzoate |
| Structure | |
| Source | ToxinDB |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1186 |
| Name | Salicylic Acid |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1187 |
| Name | Benzyl Alcohol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1188 |
| Name | 4-Hydroxybenzoic Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1189 |
| Name | Methyl Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1190 |
| Name | 3-Hydroxybenzoic Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1192 |
| Name | P-AMINOBENZOIC ACID |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1193 |
| Name | BENZALDEHYDE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1194 |
| Name | BENZYL ALCOHOL |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1195 |
| Name | 4-HYDROXYBENZOIC ACID |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1196 |
| Name | 3-HYDROXYBENZOIC ACID |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1197 |
| Name | METHYL BENZOATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1198 |
| Name | 2-Thiosalicylic acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1199 |
| Name | M-Toluic acid |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1200 |
| Name | P-Toluic acid |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1201 |
| Name | 4-bromobenzoic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1202 |
| Name | 3-Chlorobenzoic acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1174 |
| Name | 4-Hydroxybenzoic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1179 |
| Name | 6-Aminobenzoic Acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, DEA Chemicals, DrugBank, HPV EPA Chemicals, CAC Veterinary Drug, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1184 |
| Name | 4-Chlorobenzoic Acid |
| Structure | |
| Source | DrugBank, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P1191 |
| Name | 2-Aminobenzoic acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, DEA Chemicals, DrugBank, HPV EPA Chemicals, CAC Veterinary Drug, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Benzoic acid |
| PubChem Link | Link |
| ID | P0183 |
| Name | Borate |
| Structure | |
| Source | ToxinDB, OpenFoodTox |
| Basis of prediction | Boric acid |
| PubChem Link | Link |
| ID | P0184 |
| Name | Aluminium(3+) Borate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Boric acid |
| PubChem Link | Link |
| ID | P0185 |
| Name | Diammonium Tetraborate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Boric acid |
| PubChem Link | Link |
| ID | P0186 |
| Name | Zinc borate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Boric acid |
| PubChem Link | Link |
| ID | P0187 |
| Name | Boric acid, sodium salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Boric acid |
| PubChem Link | Link |
| ID | P0188 |
| Name | Boric acid, potassium salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Boric acid |
| PubChem Link | Link |
| ID | P0189 |
| Name | Boric acid, aluminum salt |
| Structure | |
| Source | FRCD |
| Basis of prediction | Boric acid |
| PubChem Link | Link |
| ID | P0190 |
| Name | Zinc borate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Boric acid |
| PubChem Link | Link |
| ID | P0019 |
| Name | Propylparaben |
| Structure | |
| Source | HPV EPA Chemicals, ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P0018 |
| Name | Propyl paraben |
| Structure | |
| Source | HPV EPA Chemicals, ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1219 |
| Name | Benzyl Butyl Ether |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1218 |
| Name | Pentyl Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1203 |
| Name | Ethyl 4-hydroxybenzoate |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1204 |
| Name | Ethyl paraben sodium |
| Structure | |
| Source | ToxinDB, OpenFoodTox |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1205 |
| Name | Ethylparaben |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1206 |
| Name | Heptyl 4-Hydroxybenzoate |
| Structure | |
| Source | ToxinDB, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1207 |
| Name | Heptyl 4-hydroxybenzoate |
| Structure | |
| Source | ToxinDB, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1208 |
| Name | Isobutylparaben |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1209 |
| Name | Isopentyl benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1210 |
| Name | 3-Methylbut-3-enyl benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1211 |
| Name | Butyl benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1212 |
| Name | Pentyl benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1213 |
| Name | Butyl salicylate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1214 |
| Name | Benzyl butyl ether |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1215 |
| Name | Butyl anthranilate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1216 |
| Name | Propyl benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1217 |
| Name | 3-Methyl-3-Butenyl Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1221 |
| Name | Isopentyl Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1222 |
| Name | Propyl Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1223 |
| Name | Butyl Salicylate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1224 |
| Name | Butyl Benzoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1225 |
| Name | BUTYL ANTHRANILATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1226 |
| Name | ISOAMYL BENZOATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1227 |
| Name | Butyl 4-aminobenzoate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1228 |
| Name | PROPYL BENZOATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1220 |
| Name | Butyl Anthranilate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Butyl p-hydroxybenzoate |
| PubChem Link | Link |
| ID | P1229 |
| Name | Acetic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium acetate |
| PubChem Link | Link |
| ID | P1230 |
| Name | Acetic Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium acetate |
| PubChem Link | Link |
| ID | P1231 |
| Name | AC-(D)PHE-PRO-BOROHOMOORNITHINE-OH |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Calcium benzoate |
| PubChem Link | Link |
| ID | P1232 |
| Name | AC-(D)PHE-PRO-BOROHOMOLYS-OH |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Calcium benzoate |
| PubChem Link | Link |
| ID | P1233 |
| Name | AC-(D)PHE-PRO-BOROLYS-OH |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Calcium benzoate |
| PubChem Link | Link |
| ID | P0020 |
| Name | Ferric sodium EDTA trihydrate |
| Structure | |
| Source | OpenFoodTox |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P0021 |
| Name | Monosodium Edetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P0022 |
| Name | Trimethylenediaminetetraacetic acid |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1353 |
| Name | Diethylenetriaminepentaacetic acid |
| Structure | |
| Source | HPV EPA Chemicals, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1327 |
| Name | Ferric sodium EDTA anhydrous |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1328 |
| Name | Calcium disodium EDTA |
| Structure | |
| Source | OpenFoodTox |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1329 |
| Name | Heedta |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1330 |
| Name | Tetraxetan |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1331 |
| Name | Calcium disodium EDTA |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1332 |
| Name | Dicobalt Edetate |
| Structure | |
| Source | IARC Carcinogens Group 2B, T3DB, FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1333 |
| Name | Edetate Disodium |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1334 |
| Name | Sodium Edetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1335 |
| Name | Edta Iron Disodium Salt |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1336 |
| Name | Ferric Versenate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1337 |
| Name | Edetate Tripotassium |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1338 |
| Name | 139-89-9 |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1340 |
| Name | Tetrapotassium Edta |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1341 |
| Name | Sodium ferric EDTA |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1342 |
| Name | Sodium Feredetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1343 |
| Name | Pentasodium Dtpa |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1344 |
| Name | Dicobalt edetate |
| Structure | |
| Source | IARC Carcinogens Group 2B, T3DB, FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1345 |
| Name | EDTA, TETRASODIUM |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1346 |
| Name | ETHYLENEDIAMINETETRAACETIC ACID DISODIUM SALT |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1347 |
| Name | Glycine, N-[2-[bis(carboxymethyl)amino]ethyl]-N-( 2-hydroxyethyl)-, sodium salt (1:2) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1348 |
| Name | Sodium hydrogen ferric diethylenetriaminepentacetate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1349 |
| Name | Magnesate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, disodium, (OC-6-21)- |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1350 |
| Name | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, tetraammonium salt |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1351 |
| Name | Ferrous sodium HEDTA |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1352 |
| Name | Glycine, N-(carboxymethyl)-N-[2-[(carboxymethyl)amino]ethyl]-, sodium salt (1:3) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1355 |
| Name | Iron, [N-[2-[bis[(carboxy-.kappa.O)methyl]amino-.kappa.N]ethyl]-N-[2-(hydroxy-.kappa.O)ethyl]glycinato(3-)-.kappa.N,.kappa.O] |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1356 |
| Name | Glycine, N,N-bis[2-[(carboxymethyl)amino]ethyl]-, potassium salt (1:?) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1357 |
| Name | Glycine, N-[2-[bis(carboxymethyl)amino]ethyl]-N-( 2-hydroxyethyl)-, sodium salt (1:1) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1358 |
| Name | Disodium manganese EDTA |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1359 |
| Name | Versen-ol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1360 |
| Name | Gadoteric acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1361 |
| Name | Pentasodium pentetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1362 |
| Name | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, diammonium salt |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1364 |
| Name | Zincate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, disodium, (OC-6-21)- |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1365 |
| Name | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, tetrapotassium salt |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1366 |
| Name | Sodium iron(III) ethylenediaminetetraacetate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1367 |
| Name | Magnesate(2-), [[N,N'-1,2-ethanediylbis[N-(carboxymethyl)glycinato]](4-)-N,N',O,O',ON,ON']-, dipotassium, (OC-6-21)- |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1368 |
| Name | Edetic Acid |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P0023 |
| Name | Zincate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, diammonium, (OC-6-21-)- |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1339 |
| Name | Pentetic acid |
| Structure | |
| Source | HPV EPA Chemicals, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1354 |
| Name | Edetate trisodium |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1363 |
| Name | Cuprate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, disodium, (OC-6-21)- |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Edetic acid |
| PubChem Link | Link |
| ID | P1369 |
| Name | Sodium sulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium hydrogen sulfite |
| PubChem Link | Link |
| ID | P1370 |
| Name | Sodium Sulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium hydrogen sulfite |
| PubChem Link | Link |
| ID | P1371 |
| Name | SODIUM SULFITE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium hydrogen sulfite |
| PubChem Link | Link |
| ID | P0024 |
| Name | Propanoic acid, cobalt(2+) salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P0025 |
| Name | Propanoic acid, manganese(2+) salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1372 |
| Name | Propionic acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB, OECD HPV Chemicals |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1373 |
| Name | Sodium propionate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1374 |
| Name | Ammonium propionate |
| Structure | |
| Source | ToxinDB, OpenFoodTox |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1375 |
| Name | Potassium propionate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1376 |
| Name | Propanoic Acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB, OECD HPV Chemicals |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1377 |
| Name | Potassium Propionate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1378 |
| Name | Sodium Propionate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1379 |
| Name | Propionic Acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB, OECD HPV Chemicals |
| Basis of prediction | Calcium propionate |
| PubChem Link | Link |
| ID | P1380 |
| Name | Potassium sorbate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium Sorbate |
| PubChem Link | Link |
| ID | P1381 |
| Name | (E,E)-Hexa-2,4-dienoic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium Sorbate |
| PubChem Link | Link |
| ID | P1383 |
| Name | (2E,4E)-hexa-2,4-dienoate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium Sorbate |
| PubChem Link | Link |
| ID | P1384 |
| Name | (2E,4E)-2,4-Hexadienoic Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium Sorbate |
| PubChem Link | Link |
| ID | P1385 |
| Name | Sodium Sorbate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium Sorbate |
| PubChem Link | Link |
| ID | P1386 |
| Name | Potassium Sorbate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium Sorbate |
| PubChem Link | Link |
| ID | P1387 |
| Name | (2E,4E)-2,4-Hexadienoic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium Sorbate |
| PubChem Link | Link |
| ID | P1382 |
| Name | POTASSIUM SORBATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Calcium Sorbate |
| PubChem Link | Link |
| ID | P0026 |
| Name | Ethyl lauroyl arginate |
| Structure | |
| Source | ToxinDB, OpenFoodTox |
| Basis of prediction | Ethyl lauroyl arginate |
| PubChem Link | Link |
| ID | P0027 |
| Name | Ammonium formate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1402 |
| Name | Potassium diformate |
| Structure | |
| Source | T3DB, OpenFoodTox |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1403 |
| Name | Calcium formate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1404 |
| Name | Ammonium formate |
| Structure | |
| Source | HPV EPA Chemicals, DEA Chemicals, T3DB, OpenFoodTox, OECD HPV Chemicals |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1405 |
| Name | Sodium formate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1406 |
| Name | Formate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1407 |
| Name | AMMONIUM FORMATE |
| Structure | |
| Source | HPV EPA Chemicals, DEA Chemicals, T3DB, OpenFoodTox, OECD HPV Chemicals |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1408 |
| Name | Cobalt(Ii) Formate |
| Structure | |
| Source | IARC Carcinogens Group 2B, T3DB, FRCD |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1409 |
| Name | Nickel Formate |
| Structure | |
| Source | FRCD, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1410 |
| Name | Sodium Formate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1411 |
| Name | SODIUM FORMATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1412 |
| Name | Aluminum triformate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1413 |
| Name | Formic acid, potassium salt |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1414 |
| Name | Ammonium Formate |
| Structure | |
| Source | HPV EPA Chemicals, DEA Chemicals, T3DB, OpenFoodTox, OECD HPV Chemicals |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1415 |
| Name | Formic acid, cesium salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1417 |
| Name | Nickel formate |
| Structure | |
| Source | FRCD, T3DB, IARC Carcinogens Group 1 |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1416 |
| Name | Cobalt(II) formate |
| Structure | |
| Source | IARC Carcinogens Group 2B, T3DB, FRCD |
| Basis of prediction | Formic acid |
| PubChem Link | Link |
| ID | P1419 |
| Name | Superoxide |
| Structure | |
| Source | T3DB |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1420 |
| Name | Zinc superoxide |
| Structure | |
| Source | T3DB |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1421 |
| Name | Potassium Tetraperoxochromate(V) |
| Structure | |
| Source | FRCD, T3DB |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1422 |
| Name | Calcium Peroxide |
| Structure | |
| Source | FRCD |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1423 |
| Name | Barium Peroxide |
| Structure | |
| Source | FRCD |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1424 |
| Name | Zinc peroxide |
| Structure | |
| Source | T3DB |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1425 |
| Name | Barium peroxide |
| Structure | |
| Source | FRCD |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1426 |
| Name | Uranium peroxide |
| Structure | |
| Source | T3DB |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1427 |
| Name | Potassium tetraperoxochromate(V) |
| Structure | |
| Source | FRCD, T3DB |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1428 |
| Name | CALCIUM PEROXIDE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Hydrogen peroxide |
| PubChem Link | Link |
| ID | P1429 |
| Name | Amphotericin B |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Natamycin |
| PubChem Link | Link |
| ID | P1430 |
| Name | Amphozone |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Natamycin |
| PubChem Link | Link |
| ID | P1431 |
| Name | Amphotericin b |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Natamycin |
| PubChem Link | Link |
| ID | P1432 |
| Name | Nystatin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Natamycin |
| PubChem Link | Link |
| ID | P1433 |
| Name | Nystatin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Natamycin |
| PubChem Link | Link |
| ID | P1501 |
| Name | Benzoic Acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB, OECD HPV Chemicals |
| Basis of prediction | Potassium benzoate |
| PubChem Link | Link |
| ID | P1500 |
| Name | Benzoic acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB, OECD HPV Chemicals |
| Basis of prediction | Potassium benzoate |
| PubChem Link | Link |
| ID | P1502 |
| Name | Sodium metabisulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Potassium metabisulfite |
| PubChem Link | Link |
| ID | P1503 |
| Name | Sodium Metabisulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Potassium metabisulfite |
| PubChem Link | Link |
| ID | P1504 |
| Name | SODIUM METABISULFITE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Potassium metabisulfite |
| PubChem Link | Link |
| ID | P0050 |
| Name | Nitrate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Potassium nitrate |
| PubChem Link | Link |
| ID | P0051 |
| Name | Nitrite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Potassium nitrite |
| PubChem Link | Link |
| ID | P1511 |
| Name | Calcium propionate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Potassium propionate |
| PubChem Link | Link |
| ID | P1512 |
| Name | Calcium Propionate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Potassium propionate |
| PubChem Link | Link |
| ID | P1513 |
| Name | CALCIUM PROPIONATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Potassium propionate |
| PubChem Link | Link |
| ID | P1514 |
| Name | Poloxamer 188 |
| Structure | |
| Source | FRCD |
| Basis of prediction | Propylene oxide |
| PubChem Link | Link |
| ID | P1515 |
| Name | Salicylate-sodium |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1516 |
| Name | Magnesium salicylate |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1517 |
| Name | Trisalicylate-choline |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1518 |
| Name | Sodium Salicylate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1519 |
| Name | Trolamine salicylate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1520 |
| Name | Sodium salicylate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1521 |
| Name | Benzoic acid, 2-hydroxy-, dilithium salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1523 |
| Name | Methyl salicylate |
| Structure | |
| Source | HPV EPA Chemicals, ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1524 |
| Name | 2,4-Dihydroxybenzoic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1525 |
| Name | Aminosalicylic Acid |
| Structure | |
| Source | DrugBank, ToxinDB |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1526 |
| Name | 2,4-Dihydroxybenzoic Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1527 |
| Name | 2,3-Dihydroxy-Benzoic Acid |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1528 |
| Name | Mesalazine |
| Structure | |
| Source | DrugBank, ToxinDB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1529 |
| Name | 5-Aminosalicylic acid |
| Structure | |
| Source | DrugBank, ToxinDB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1530 |
| Name | Gentisic acid |
| Structure | |
| Source | ToxinDB |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1531 |
| Name | 4-Aminosalicylic acid |
| Structure | |
| Source | DrugBank, ToxinDB |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1532 |
| Name | Methyl 2-Hydroxybenzoate |
| Structure | |
| Source | HPV EPA Chemicals, ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1533 |
| Name | 2-Hydroxybenzaldehyde |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, HPV EPA Chemicals, ToxinDB, T3DB, OECD HPV Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1534 |
| Name | 2-Methoxybenzoic Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1535 |
| Name | Salicyl Alcohol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1536 |
| Name | Methyl 2-hydroxybenzoate |
| Structure | |
| Source | HPV EPA Chemicals, ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1537 |
| Name | 2,4-DIHYDROXYBENZOIC ACID |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1538 |
| Name | 4 - Chlorsalicylsäure |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1539 |
| Name | 3-chlorosalicylic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1540 |
| Name | 3-bromosalicylic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1541 |
| Name | 5-bromosalicylic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1542 |
| Name | Gentisic acid |
| Structure | |
| Source | ToxinDB |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1543 |
| Name | 2-Hydroxy-3-methylbenzoic acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1522 |
| Name | Salicylaldehyde |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, HPV EPA Chemicals, ToxinDB, T3DB, OECD HPV Chemicals |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1544 |
| Name | Salicyl alcohol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Salicylic acid |
| PubChem Link | Link |
| ID | P1545 |
| Name | Dichloroisocyanuric Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium dichloroisocyanurate |
| PubChem Link | Link |
| ID | P1546 |
| Name | Trichloroisocyanuric Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium dichloroisocyanurate |
| PubChem Link | Link |
| ID | P1547 |
| Name | 1,3,5-Trichloroisocyanuric acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium dichloroisocyanurate |
| PubChem Link | Link |
| ID | P1548 |
| Name | Dichloroisocyanuric acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium dichloroisocyanurate |
| PubChem Link | Link |
| ID | P1572 |
| Name | 2-Phenylphenol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium o-phenylphenate |
| PubChem Link | Link |
| ID | P1573 |
| Name | 2-Biphenylol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium o-phenylphenate |
| PubChem Link | Link |
| ID | P1022 |
| Name | Sodium bisulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1023 |
| Name | Calcium sulfite |
| Structure | |
| Source | CAC Veterinary Drug, OpenFoodTox |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1024 |
| Name | Calcium bisulfite |
| Structure | |
| Source | OpenFoodTox |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1025 |
| Name | Sulfonate |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1026 |
| Name | Calcium bisulfite |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1027 |
| Name | Potassium Sulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1028 |
| Name | Sodium Bisulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1029 |
| Name | Sulfurous Acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1030 |
| Name | Bisulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1032 |
| Name | Ammonium bisulfite |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1033 |
| Name | POTASSIUM BISULFITE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1034 |
| Name | POTASSIUM SULFITE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1035 |
| Name | SULFUROUS ACID |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1036 |
| Name | Sulfurous acid, magnesium salt (1:1) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P1031 |
| Name | Potassium Bisulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium sulfite |
| PubChem Link | Link |
| ID | P0052 |
| Name | Thiosulfate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1586 |
| Name | Lead Thiosulfate |
| Structure | |
| Source | FRCD, IARC Carcinogens Group 2A, T3DB |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1587 |
| Name | Sodium Thiosulfate Pentahydrate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1588 |
| Name | Ammonium Thiosulphate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1589 |
| Name | Calcium thiosulfate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1590 |
| Name | Thiosulfuric acid, magnesium salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1591 |
| Name | Potassium thiosulfate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1592 |
| Name | SODIUM THIOSULFATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1593 |
| Name | Lead thiosulfate |
| Structure | |
| Source | FRCD, IARC Carcinogens Group 2A, T3DB |
| Basis of prediction | Sodium thiosulfate |
| PubChem Link | Link |
| ID | P1391 |
| Name | Calcium sorbate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1392 |
| Name | Calcium Sorbate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1393 |
| Name | CALCIUM SORBATE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1394 |
| Name | Hexa-2,4-dien-1-ol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1395 |
| Name | Hexa-2(trans),4(trans)-dienal |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1396 |
| Name | Methyl (E,E)-hexa-2,4-dienoic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1397 |
| Name | 2,4-Hexadien-1-Ol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1398 |
| Name | 2,4-Hexadienal |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1399 |
| Name | Methyl Sorbate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1401 |
| Name | (2E,4E)-Hexa-2,4-dien-1-ol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P1400 |
| Name | TRANS, TRANS-2,4-HEXADIENAL |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sorbic acid |
| PubChem Link | Link |
| ID | P0083 |
| Name | Potassium Saccharin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Saccharinnatrium |
| PubChem Link | Link |
| ID | P1966 |
| Name | 7-Methyl-1,2-benzisothiazol-3(2H)-one 1,1-dioxide |
| Structure | |
| Source | FRCD |
| Basis of prediction | Saccharinnatrium |
| PubChem Link | Link |
| ID | P1967 |
| Name | Ethametsulfuron methyl metabolite (IN-00581) |
| Structure | |
| Source | FRCD |
| Basis of prediction | Saccharinnatrium |
| PubChem Link | Link |
| ID | P1968 |
| Name | Saccharin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Saccharinnatrium |
| PubChem Link | Link |
| ID | P1969 |
| Name | Saccharin (manufacturing) |
| Structure | |
| Source | FRCD |
| Basis of prediction | Saccharinnatrium |
| PubChem Link | Link |
| ID | P1970 |
| Name | 1,2-benzisothiazol-3(2H)-one 1,1-dioxide |
| Structure | |
| Source | FRCD |
| Basis of prediction | Saccharinnatrium |
| PubChem Link | Link |
| ID | P1971 |
| Name | SACCHARIN, CALCIUM SALT |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Saccharinnatrium |
| PubChem Link | Link |
| ID | P1972 |
| Name | 4-hydroxy-1H-1,2-benzisothiazole-1,1,3(2H)-trione |
| Structure | |
| Source | FRCD |
| Basis of prediction | Saccharinnatrium |
| PubChem Link | Link |
| ID | P1775 |
| Name | Calcium Cyclamate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cyclamate |
| PubChem Link | Link |
| ID | P1776 |
| Name | Sodium Cyclamate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cyclamate |
| PubChem Link | Link |
| ID | P1777 |
| Name | Unii-444I70G3Ue |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cyclamate |
| PubChem Link | Link |
| ID | P1778 |
| Name | Potassium Cyclamate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cyclamate |
| PubChem Link | Link |
| ID | P1779 |
| Name | Cyclamate Calcium Dihydrate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cyclamate |
| PubChem Link | Link |
| ID | P1781 |
| Name | SODIUM CYCLAMATE--PROHIBITED |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cyclamate |
| PubChem Link | Link |
| ID | P1780 |
| Name | MAGNESIUM CYCLAMATE--PROHIBITED |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cyclamate |
| PubChem Link | Link |
| ID | P1782 |
| Name | ACESULFAME |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acesulfame potassium |
| PubChem Link | Link |
| ID | P1783 |
| Name | Acetosulfam |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acesulfame potassium |
| PubChem Link | Link |
