4-hydroxy-1H-1,2-benzisothiazole-1,1,3(2H)-trione (Predicted)
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | P1972 |
| Molecular Name | 4-hydroxy-1H-1,2-benzisothiazole-1,1,3(2H)-trione |
| Basis for prediction | Saccharinnatrium |
| Similarity (based on Tanimoto coefficient and ECFP6 fingerprint) | 0.4186 |
| Similarity (based on Tanimoto coefficient and Daylight fingerprint) | 0.7909 |
| Similarity (based on MCS) | 0.8571 |
| 2D Structure | |
| SMILES | O=C1NS(=O)(=O)c2cccc(O)c21 |
| CFM-ID 3.0 (Copy SMILES to the website's input box) | URL Link |
| Update Date | Jul 30, 2019 14:16 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.7362 |
| Human Intestinal Absorption | HIA+ | 0.9950 |
| Caco-2 Permeability | Caco2- | 0.6406 |
| P-glycoprotein Substrate | Non-substrate | 0.8007 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9759 |
| Non-inhibitor | 0.9788 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9383 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5762 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6347 |
| CYP450 2D6 Substrate | Non-substrate | 0.8470 |
| CYP450 3A4 Substrate | Non-substrate | 0.7092 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7826 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7374 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9181 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8840 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9315 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9136 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9838 |
| Non-inhibitor | 0.8884 | |
| AMES Toxicity | Non AMES toxic | 0.8094 |
| Carcinogens | Non-carcinogens | 0.6999 |
| Fish Toxicity | High FHMT | 0.6555 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7808 |
| Honey Bee Toxicity | Low HBT | 0.5949 |
| Biodegradation | Not ready biodegradable | 0.5751 |
| Acute Oral Toxicity | III | 0.6303 |
| Carcinogenicity (Three-class) | Non-required | 0.6673 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.4651 | LogS |
| Caco-2 Permeability | 0.3967 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.1576 | LD50, mol/kg |
| Fish Toxicity | 2.9830 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.2424 | pIGC50, ug/L |
References
| Title | Data Sources |
|---|---|
| Source | FRCD |
| PubChem Link | URL Link |